C10H11F2NS — CID 141445299
2-(difluoromethylsulfanyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 141445299) has the molecular formula C10H11F2NS and a molecular weight of 215.27 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(difluoromethylsulfanyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 141445299 |
| Molecular Formula | C10H11F2NS |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | FC(F)SN1CCc2ccccc2C1 |
| InChI | InChI=1S/C10H11F2NS/c11-10(12)14-13-6-5-8-3-1-2-4-9(8)7-13/h1-4,10H,5-7H2 |
| InChIKey | OPBGONCRMNHOKK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|