C22H28N6S — CID 143831494
1-cyano-2-[6-(3,4-dihydro-1H-isoquinolin-2-ylsulfanyl)hexyl]-3-pyridin-4-ylguanidine (PubChem CID 143831494) has the molecular formula C22H28N6S and a molecular weight of 408.58 g/mol. Its IUPAC name is 1-cyano-2-[6-(3,4-dihydro-1H-isoquinolin-2-ylsulfanyl)hexyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[6-(3,4-dihydro-1H-isoquinolin-2-ylsulfanyl)hexyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 143831494 |
| Molecular Formula | C22H28N6S |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 1-cyano-2-[6-(3,4-dihydro-1H-isoquinolin-2-ylsulfanyl)hexyl]-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\CCCCCCSN1CCc2ccccc2C1)Nc1ccncc1 |
| InChI | InChI=1S/C22H28N6S/c23-18-26-22(27-21-9-13-24-14-10-21)25-12-5-1-2-6-16-29-28-15-11-19-7-3-4-8-20(19)17-28/h3-4,7-10,13-14H,1-2,5-6,11-12,15-17H2,(H2,24,25,26,27) |
| InChIKey | HAZCQFBFSLQIST-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|