C25H32N6O3 — CID 168813843
1-cyano-2-[5-[1-(2,6-dimethoxybenzoyl)pyrrolidin-3-yl]pentyl]-3-pyridin-4-ylguanidine (PubChem CID 168813843) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-cyano-2-[5-[1-(2,6-dimethoxybenzoyl)pyrrolidin-3-yl]pentyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[5-[1-(2,6-dimethoxybenzoyl)pyrrolidin-3-yl]pentyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 168813843 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 1-cyano-2-[5-[1-(2,6-dimethoxybenzoyl)pyrrolidin-3-yl]pentyl]-3-pyridin-4-ylguanidine |
| SMILES | COc1cccc(OC)c1C(=O)N1CCC(CCCCC/N=C(\NC#N)Nc2ccncc2)C1 |
| InChI | InChI=1S/C25H32N6O3/c1-33-21-8-6-9-22(34-2)23(21)24(32)31-16-12-19(17-31)7-4-3-5-13-28-25(29-18-26)30-20-10-14-27-15-11-20/h6,8-11,14-15,19H,3-5,7,12-13,16-17H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | CBJVOIHWJZORTM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|