C25H32FN7O3 — CID 168813849
1-cyano-2-[5-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]pentyl]-3-(3-fluoro-4-pyridinyl)guanidine (PubChem CID 168813849) has the molecular formula C25H32FN7O3 and a molecular weight of 497.58 g/mol. Its IUPAC name is 1-cyano-2-[5-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]pentyl]-3-(3-fluoro-4-pyridinyl)guanidine.
| Compound Name | 1-cyano-2-[5-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]pentyl]-3-(3-fluoro-4-pyridinyl)guanidine |
|---|---|
| PubChem CID | 168813849 |
| Molecular Formula | C25H32FN7O3 |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 1-cyano-2-[5-[4-(2,6-dimethoxybenzoyl)piperazin-1-yl]pentyl]-3-(3-fluoro-4-pyridinyl)guanidine |
| SMILES | COc1cccc(OC)c1C(=O)N1CCN(CCCCC/N=C(\NC#N)Nc2ccncc2F)CC1 |
| InChI | InChI=1S/C25H32FN7O3/c1-35-21-7-6-8-22(36-2)23(21)24(34)33-15-13-32(14-16-33)12-5-3-4-10-29-25(30-18-27)31-20-9-11-28-17-19(20)26/h6-9,11,17H,3-5,10,12-16H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | FOOAKGXWZYLNLB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|