C29H41N7O2 — CID 89051917
N-[8-[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]octyl]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 89051917) has the molecular formula C29H41N7O2 and a molecular weight of 519.69 g/mol. Its IUPAC name is N-[8-[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]octyl]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | N-[8-[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]octyl]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 89051917 |
| Molecular Formula | C29H41N7O2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | N-[8-[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]octyl]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | N#CN/C(=N\CCCCCCCCN(CCCN1CCOCC1)C(=O)c1ccccc1)Nc1ccncc1 |
| InChI | InChI=1S/C29H41N7O2/c30-25-33-29(34-27-13-16-31-17-14-27)32-15-8-3-1-2-4-9-19-36(28(37)26-11-6-5-7-12-26)20-10-18-35-21-23-38-24-22-35/h5-7,11-14,16-17H,1-4,8-10,15,18-24H2,(H2,31,32,33,34) |
| InChIKey | OMBMPMNSZDKHPR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 105.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|