C22H38N8O — CID 150305183
2-[8-[amino(3-morpholin-4-ylpropyl)amino]octyl]-1-cyano-3-pyridin-4-ylguanidine (PubChem CID 150305183) has the molecular formula C22H38N8O and a molecular weight of 430.60 g/mol. Its IUPAC name is 2-[8-[amino(3-morpholin-4-ylpropyl)amino]octyl]-1-cyano-3-pyridin-4-ylguanidine.
| Compound Name | 2-[8-[amino(3-morpholin-4-ylpropyl)amino]octyl]-1-cyano-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 150305183 |
| Molecular Formula | C22H38N8O |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | 2-[8-[amino(3-morpholin-4-ylpropyl)amino]octyl]-1-cyano-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\CCCCCCCCN(N)CCCN1CCOCC1)Nc1ccncc1 |
| InChI | InChI=1S/C22H38N8O/c23-20-27-22(28-21-8-11-25-12-9-21)26-10-5-3-1-2-4-6-14-30(24)15-7-13-29-16-18-31-19-17-29/h8-9,11-12H,1-7,10,13-19,24H2,(H2,25,26,27,28) |
| InChIKey | GKLDHWMTSATBMZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|