C22H33F3N6O3S — CID 89051753
1-cyano-2-[6-[cyclohexylmethoxy(2,2,2-trifluoroethylsulfonyl)amino]hexyl]-3-pyridin-4-ylguanidine (PubChem CID 89051753) has the molecular formula C22H33F3N6O3S and a molecular weight of 518.61 g/mol. Its IUPAC name is 1-cyano-2-[6-[cyclohexylmethoxy(2,2,2-trifluoroethylsulfonyl)amino]hexyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[6-[cyclohexylmethoxy(2,2,2-trifluoroethylsulfonyl)amino]hexyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 89051753 |
| Molecular Formula | C22H33F3N6O3S |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 1-cyano-2-[6-[cyclohexylmethoxy(2,2,2-trifluoroethylsulfonyl)amino]hexyl]-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\CCCCCCN(OCC1CCCCC1)S(=O)(=O)CC(F)(F)F)Nc1ccncc1 |
| InChI | InChI=1S/C22H33F3N6O3S/c23-22(24,25)17-35(32,33)31(34-16-19-8-4-3-5-9-19)15-7-2-1-6-12-28-21(29-18-26)30-20-10-13-27-14-11-20/h10-11,13-14,19H,1-9,12,15-17H2,(H2,27,28,29,30) |
| InChIKey | XSGKFGIWOVEOOH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|