C22H39N5O3S — CID 89004019
2-[6-[cyclohexylmethoxy(propan-2-ylsulfonyl)amino]hexyl]-1-pyridin-4-ylguanidine (PubChem CID 89004019) has the molecular formula C22H39N5O3S and a molecular weight of 453.65 g/mol. Its IUPAC name is 2-[6-[cyclohexylmethoxy(propan-2-ylsulfonyl)amino]hexyl]-1-pyridin-4-ylguanidine.
| Compound Name | 2-[6-[cyclohexylmethoxy(propan-2-ylsulfonyl)amino]hexyl]-1-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 89004019 |
| Molecular Formula | C22H39N5O3S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 2-[6-[cyclohexylmethoxy(propan-2-ylsulfonyl)amino]hexyl]-1-pyridin-4-ylguanidine |
| SMILES | CC(C)S(=O)(=O)N(CCCCCC/N=C(\N)Nc1ccncc1)OCC1CCCCC1 |
| InChI | InChI=1S/C22H39N5O3S/c1-19(2)31(28,29)27(30-18-20-10-6-5-7-11-20)17-9-4-3-8-14-25-22(23)26-21-12-15-24-16-13-21/h12-13,15-16,19-20H,3-11,14,17-18H2,1-2H3,(H3,23,24,25,26) |
| InChIKey | BJGADKRVHRJVEV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|