C28H40N6O3S — CID 143831584
2-[6-[benzyl(2-cyclohexylethoxy)sulfamoyl]hexyl]-1-cyano-3-pyridin-4-ylguanidine (PubChem CID 143831584) has the molecular formula C28H40N6O3S and a molecular weight of 540.73 g/mol. Its IUPAC name is 2-[6-[benzyl(2-cyclohexylethoxy)sulfamoyl]hexyl]-1-cyano-3-pyridin-4-ylguanidine.
| Compound Name | 2-[6-[benzyl(2-cyclohexylethoxy)sulfamoyl]hexyl]-1-cyano-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 143831584 |
| Molecular Formula | C28H40N6O3S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 2-[6-[benzyl(2-cyclohexylethoxy)sulfamoyl]hexyl]-1-cyano-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\CCCCCCS(=O)(=O)N(Cc1ccccc1)OCCC1CCCCC1)Nc1ccncc1 |
| InChI | InChI=1S/C28H40N6O3S/c29-24-32-28(33-27-15-19-30-20-16-27)31-18-9-1-2-10-22-38(35,36)34(23-26-13-7-4-8-14-26)37-21-17-25-11-5-3-6-12-25/h4,7-8,13-16,19-20,25H,1-3,5-6,9-12,17-18,21-23H2,(H2,30,31,32,33) |
| InChIKey | HFIXMZGATOBHLW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|