C28H48N6O6S — CID 143831630
1-cyano-2-[6-[2-cyclohexylethoxy-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]sulfamoyl]hexyl]-3-pyridin-4-ylguanidine (PubChem CID 143831630) has the molecular formula C28H48N6O6S and a molecular weight of 596.80 g/mol. Its IUPAC name is 1-cyano-2-[6-[2-cyclohexylethoxy-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]sulfamoyl]hexyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[6-[2-cyclohexylethoxy-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]sulfamoyl]hexyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 143831630 |
| Molecular Formula | C28H48N6O6S |
| Molecular Weight | 596.80 g/mol |
| Exact Mass | 596.34 |
| IUPAC Name | 1-cyano-2-[6-[2-cyclohexylethoxy-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]sulfamoyl]hexyl]-3-pyridin-4-ylguanidine |
| SMILES | COCCOCCOCCN(OCCC1CCCCC1)S(=O)(=O)CCCCCC/N=C(\NC#N)Nc1ccncc1 |
| InChI | InChI=1S/C28H48N6O6S/c1-37-20-21-39-23-22-38-19-17-34(40-18-13-26-9-5-4-6-10-26)41(35,36)24-8-3-2-7-14-31-28(32-25-29)33-27-11-15-30-16-12-27/h11-12,15-16,26H,2-10,13-14,17-24H2,1H3,(H2,30,31,32,33) |
| InChIKey | ZFASTNVDHZGSFV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|