C17H25N5O2 — CID 143831521
10-[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]decanoic acid (PubChem CID 143831521) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 10-[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]decanoic acid.
| Compound Name | 10-[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]decanoic acid |
|---|---|
| PubChem CID | 143831521 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 10-[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]decanoic acid |
| SMILES | N#CN/C(=N\CCCCCCCCCC(=O)O)Nc1ccncc1 |
| InChI | InChI=1S/C17H25N5O2/c18-14-21-17(22-15-9-12-19-13-10-15)20-11-7-5-3-1-2-4-6-8-16(23)24/h9-10,12-13H,1-8,11H2,(H,23,24)(H2,19,20,21,22) |
| InChIKey | WIFSRENMKMNNCY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|