About 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide
8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide (PubChem CID 134458704) has the molecular formula C18H27N5O
and a molecular weight of 329.45 g/mol. Its IUPAC name is 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide.
Molecular Properties
| Compound Name | 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide |
| PubChem CID | 134458704 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide |
| SMILES | CN(C)C(=O)CCCCCCC/N=C(\NC#N)Nc1ccccc1 |
| InChI | InChI=1S/C18H27N5O/c1-23(2)17(24)13-9-4-3-5-10-14-20-18(21-15-19)22-16-11-7-6-8-12-16/h6-8,11-12H,3-5,9-10,13-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | IKYDLEQZWPXFEQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide?
The IUPAC name of 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide (CID 134458704) is 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide.
What is the SMILES notation for 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide?
The canonical SMILES for 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide is CN(C)C(=O)CCCCCCC/N=C(\NC#N)Nc1ccccc1.
What is the InChIKey of 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide?
The InChIKey is IKYDLEQZWPXFEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5O/c1-23(2)17(24)13-9-4-3-5-10-14-20-18(21-15-19)22-16-11-7-6-8-12-16/h6-8,11-12H,3-5,9-10,13-14H2,1-2H3,(H2,20,21,22).
What are the key properties of 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide?
8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide has a molecular weight of 329.45 g/mol, XLogP of 2.95, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide is sourced from PubChem (CID 134458704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).