C18H27N5O — CID 134458704
8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide (PubChem CID 134458704) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide.
| Compound Name | 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide |
|---|---|
| PubChem CID | 134458704 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 8-[[anilino-(cyanoamino)methylidene]amino]-N,N-dimethyloctanamide |
| SMILES | CN(C)C(=O)CCCCCCC/N=C(\NC#N)Nc1ccccc1 |
| InChI | InChI=1S/C18H27N5O/c1-23(2)17(24)13-9-4-3-5-10-14-20-18(21-15-19)22-16-11-7-6-8-12-16/h6-8,11-12H,3-5,9-10,13-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | IKYDLEQZWPXFEQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|