C14H13N5 — CID 140989208
1-cyano-3-phenyl-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 140989208) has the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. Its IUPAC name is 1-cyano-3-phenyl-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-cyano-3-phenyl-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 140989208 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-cyano-3-phenyl-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | N#CN/C(=N\Cc1ccccn1)Nc1ccccc1 |
| InChI | InChI=1S/C14H13N5/c15-11-18-14(19-12-6-2-1-3-7-12)17-10-13-8-4-5-9-16-13/h1-9H,10H2,(H2,17,18,19) |
| InChIKey | OOEKJUZUNXKXGL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|