C20H22ClF2N5O2 — CID 53344765
2-[6-[4-chloro-2-(difluoromethoxy)phenoxy]hexyl]-1-cyano-3-pyridin-4-ylguanidine (PubChem CID 53344765) has the molecular formula C20H22ClF2N5O2 and a molecular weight of 437.88 g/mol. Its IUPAC name is 2-[6-[4-chloro-2-(difluoromethoxy)phenoxy]hexyl]-1-cyano-3-pyridin-4-ylguanidine.
| Compound Name | 2-[6-[4-chloro-2-(difluoromethoxy)phenoxy]hexyl]-1-cyano-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 53344765 |
| Molecular Formula | C20H22ClF2N5O2 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[6-[4-chloro-2-(difluoromethoxy)phenoxy]hexyl]-1-cyano-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\CCCCCCOc1ccc(Cl)cc1OC(F)F)Nc1ccncc1 |
| InChI | InChI=1S/C20H22ClF2N5O2/c21-15-5-6-17(18(13-15)30-19(22)23)29-12-4-2-1-3-9-26-20(27-14-24)28-16-7-10-25-11-8-16/h5-8,10-11,13,19H,1-4,9,12H2,(H2,25,26,27,28) |
| InChIKey | GVGGTBJQSHQANZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|