C26H34Cl2N6O3 — CID 87794365
[4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl piperidine-4-carboxylate chloride (PubChem CID 87794365) has the molecular formula C26H34Cl2N6O3 and a molecular weight of 549.50 g/mol. Its IUPAC name is [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl piperidine-4-carboxylate chloride.
| Compound Name | [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl piperidine-4-carboxylate chloride |
|---|---|
| PubChem CID | 87794365 |
| Molecular Formula | C26H34Cl2N6O3 |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl piperidine-4-carboxylate chloride |
| SMILES | N#CN/C(=N\CCCCCCOc1ccc(Cl)cc1)Nc1cc[n+](COC(=O)C2CCNCC2)cc1.[Cl-] |
| InChI | InChI=1S/C26H33ClN6O3.ClH/c27-22-5-7-24(8-6-22)35-18-4-2-1-3-13-30-26(31-19-28)32-23-11-16-33(17-12-23)20-36-25(34)21-9-14-29-15-10-21;/h5-8,11-12,16-17,21,29H,1-4,9-10,13-15,18,20H2,(H,30,31);1H |
| InChIKey | NHIXDCVVUSLXQU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|