C25H35Cl3N6O5 — CID 10371471
2-(2-aminoethoxy)ethyl [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl carbonate;chloride;hydrochloride (PubChem CID 10371471) has the molecular formula C25H35Cl3N6O5 and a molecular weight of 605.95 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl carbonate;chloride;hydrochloride.
| Compound Name | 2-(2-aminoethoxy)ethyl [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl carbonate;chloride;hydrochloride |
|---|---|
| PubChem CID | 10371471 |
| Molecular Formula | C25H35Cl3N6O5 |
| Molecular Weight | 605.95 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl carbonate;chloride;hydrochloride |
| SMILES | Cl.N#CN/C(=N\CCCCCCOc1ccc(Cl)cc1)Nc1cc[n+](COC(=O)OCCOCCN)cc1.[Cl-] |
| InChI | InChI=1S/C25H33ClN6O5.2ClH/c26-21-5-7-23(8-6-21)35-15-4-2-1-3-12-29-24(30-19-28)31-22-9-13-32(14-10-22)20-37-25(33)36-18-17-34-16-11-27;;/h5-10,13-14H,1-4,11-12,15-18,20,27H2,(H,29,30);2*1H |
| InChIKey | ABVSXFHRPHKQKI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.95 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|