C34H50ClIN6O6 — CID 10440362
[4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl 8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl carbonate iodide (PubChem CID 10440362) has the molecular formula C34H50ClIN6O6 and a molecular weight of 801.17 g/mol. Its IUPAC name is [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl 8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl carbonate iodide.
| Compound Name | [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl 8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl carbonate iodide |
|---|---|
| PubChem CID | 10440362 |
| Molecular Formula | C34H50ClIN6O6 |
| Molecular Weight | 801.17 g/mol |
| Exact Mass | 800.25 |
| IUPAC Name | [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl 8-[(2-methylpropan-2-yl)oxycarbonylamino]octyl carbonate iodide |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCCOC(=O)OC[n+]1ccc(N/C(=N/CCCCCCOc2ccc(Cl)cc2)NC#N)cc1.[I-] |
| InChI | InChI=1S/C34H49ClN6O6.HI/c1-34(2,3)47-32(42)38-21-11-6-4-5-8-13-25-45-33(43)46-27-41-22-18-29(19-23-41)40-31(39-26-36)37-20-10-7-9-12-24-44-30-16-14-28(35)15-17-30;/h14-19,22-23H,4-13,20-21,24-25,27H2,1-3H3,(H2,37,38,39,42);1H |
| InChIKey | CUFLQNVCKLQXGM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 147.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.17 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|