C27H37Cl3N6O4 — CID 87794531
[4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl piperidin-3-ylmethyl carbonate;chloride;hydrochloride (PubChem CID 87794531) has the molecular formula C27H37Cl3N6O4 and a molecular weight of 615.99 g/mol. Its IUPAC name is [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl piperidin-3-ylmethyl carbonate;chloride;hydrochloride.
| Compound Name | [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl piperidin-3-ylmethyl carbonate;chloride;hydrochloride |
|---|---|
| PubChem CID | 87794531 |
| Molecular Formula | C27H37Cl3N6O4 |
| Molecular Weight | 615.99 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl piperidin-3-ylmethyl carbonate;chloride;hydrochloride |
| SMILES | Cl.N#CN/C(=N\CCCCCCOc1ccc(Cl)cc1)Nc1cc[n+](COC(=O)OCC2CCCNC2)cc1.[Cl-] |
| InChI | InChI=1S/C27H35ClN6O4.2ClH/c28-23-7-9-25(10-8-23)36-17-4-2-1-3-14-31-26(32-20-29)33-24-11-15-34(16-12-24)21-38-27(35)37-19-22-6-5-13-30-18-22;;/h7-12,15-16,22,30H,1-6,13-14,17-19,21H2,(H,31,32);2*1H |
| InChIKey | MYEJKZCOVPGBOD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.99 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|