C28H37ClN5O5+ — CID 10232266
4-O-tert-butyl 1-O-[[4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl] butanedioate (PubChem CID 10232266) has the molecular formula C28H37ClN5O5+ and a molecular weight of 559.09 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[[4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl] butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[[4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl] butanedioate |
|---|---|
| PubChem CID | 10232266 |
| Molecular Formula | C28H37ClN5O5+ |
| Molecular Weight | 559.09 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 4-O-tert-butyl 1-O-[[4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl] butanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)OC[n+]1ccc(N/C(=N/CCCCCCOc2ccc(Cl)cc2)NC#N)cc1 |
| InChI | InChI=1S/C28H36ClN5O5/c1-28(2,3)39-26(36)13-12-25(35)38-21-34-17-14-23(15-18-34)33-27(32-20-30)31-16-6-4-5-7-19-37-24-10-8-22(29)9-11-24/h8-11,14-15,17-18H,4-7,12-13,16,19,21H2,1-3H3,(H,31,32)/p+1 |
| InChIKey | WECGKWNYRBBFHS-UHFFFAOYSA-O |
| XLogP | 4.73 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.09 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|