C25H34ClN6O3+ — CID 118221563
[4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]methyl (2R)-2-amino-3-methylbutanoate (PubChem CID 118221563) has the molecular formula C25H34ClN6O3+ and a molecular weight of 502.04 g/mol. Its IUPAC name is [4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]methyl (2R)-2-amino-3-methylbutanoate.
| Compound Name | [4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]methyl (2R)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 118221563 |
| Molecular Formula | C25H34ClN6O3+ |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | [4-[6-(4-chlorophenoxy)hexyl-(N'-cyanocarbamimidoyl)amino]pyridin-1-ium-1-yl]methyl (2R)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@@H](N)C(=O)OC[n+]1ccc(N(CCCCCCOc2ccc(Cl)cc2)/C(N)=N/C#N)cc1 |
| InChI | InChI=1S/C25H34ClN6O3/c1-19(2)23(28)24(33)35-18-31-14-11-21(12-15-31)32(25(29)30-17-27)13-5-3-4-6-16-34-22-9-7-20(26)8-10-22/h7-12,14-15,19,23H,3-6,13,16,18,28H2,1-2H3,(H2,29,30)/q+1/t23-/m1/s1 |
| InChIKey | ZPPLKYYKBZEHBP-HSZRJFAPSA-N |
| XLogP | 3.35 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|