C22H27Cl2N5O3 — CID 10116682
[4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl acetate chloride (PubChem CID 10116682) has the molecular formula C22H27Cl2N5O3 and a molecular weight of 480.40 g/mol. Its IUPAC name is [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl acetate chloride.
| Compound Name | [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl acetate chloride |
|---|---|
| PubChem CID | 10116682 |
| Molecular Formula | C22H27Cl2N5O3 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl acetate chloride |
| SMILES | CC(=O)OC[n+]1ccc(N/C(=N/CCCCCCOc2ccc(Cl)cc2)NC#N)cc1.[Cl-] |
| InChI | InChI=1S/C22H26ClN5O3.ClH/c1-18(29)31-17-28-13-10-20(11-14-28)27-22(26-16-24)25-12-4-2-3-5-15-30-21-8-6-19(23)7-9-21;/h6-11,13-14H,2-5,12,15,17H2,1H3,(H,25,26);1H |
| InChIKey | KRHODWFHXFSZRV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|