C31H33ClN5O4+ — CID 87420878
1-[1-(2-benzyl-3,6-dioxooxan-2-yl)pyridin-1-ium-4-yl]-2-[6-(4-chlorophenoxy)hexyl]-3-cyanoguanidine (PubChem CID 87420878) has the molecular formula C31H33ClN5O4+ and a molecular weight of 575.09 g/mol. Its IUPAC name is 1-[1-(2-benzyl-3,6-dioxooxan-2-yl)pyridin-1-ium-4-yl]-2-[6-(4-chlorophenoxy)hexyl]-3-cyanoguanidine.
| Compound Name | 1-[1-(2-benzyl-3,6-dioxooxan-2-yl)pyridin-1-ium-4-yl]-2-[6-(4-chlorophenoxy)hexyl]-3-cyanoguanidine |
|---|---|
| PubChem CID | 87420878 |
| Molecular Formula | C31H33ClN5O4+ |
| Molecular Weight | 575.09 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 1-[1-(2-benzyl-3,6-dioxooxan-2-yl)pyridin-1-ium-4-yl]-2-[6-(4-chlorophenoxy)hexyl]-3-cyanoguanidine |
| SMILES | N#CN/C(=N\CCCCCCOc1ccc(Cl)cc1)Nc1cc[n+](C2(Cc3ccccc3)OC(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C31H32ClN5O4/c32-25-10-12-27(13-11-25)40-21-7-2-1-6-18-34-30(35-23-33)36-26-16-19-37(20-17-26)31(22-24-8-4-3-5-9-24)28(38)14-15-29(39)41-31/h3-5,8-13,16-17,19-20H,1-2,6-7,14-15,18,21-22H2,(H,34,35)/p+1 |
| InChIKey | JVWGCLXOTJROCK-UHFFFAOYSA-O |
| XLogP | 4.91 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.09 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|