C24H33ClN7O3+ — CID 10281587
[4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl N-(3-aminopropyl)carbamate (PubChem CID 10281587) has the molecular formula C24H33ClN7O3+ and a molecular weight of 503.03 g/mol. Its IUPAC name is [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl N-(3-aminopropyl)carbamate.
| Compound Name | [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl N-(3-aminopropyl)carbamate |
|---|---|
| PubChem CID | 10281587 |
| Molecular Formula | C24H33ClN7O3+ |
| Molecular Weight | 503.03 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | [4-[[N'-[6-(4-chlorophenoxy)hexyl]-N-cyanocarbamimidoyl]amino]pyridin-1-ium-1-yl]methyl N-(3-aminopropyl)carbamate |
| SMILES | N#CN/C(=N\CCCCCCOc1ccc(Cl)cc1)Nc1cc[n+](COC(=O)NCCCN)cc1 |
| InChI | InChI=1S/C24H32ClN7O3/c25-20-6-8-22(9-7-20)34-17-4-2-1-3-13-28-23(30-18-27)31-21-10-15-32(16-11-21)19-35-24(33)29-14-5-12-26/h6-11,15-16H,1-5,12-14,17,19,26H2,(H2,28,29,30,33)/p+1 |
| InChIKey | BRVDNNYPSHDNEU-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.03 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|