C18H20FN5O — CID 46937634
1-cyano-2-[5-(3-fluorophenoxy)pentyl]-3-pyridin-4-ylguanidine (PubChem CID 46937634) has the molecular formula C18H20FN5O and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-cyano-2-[5-(3-fluorophenoxy)pentyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[5-(3-fluorophenoxy)pentyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 46937634 |
| Molecular Formula | C18H20FN5O |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-cyano-2-[5-(3-fluorophenoxy)pentyl]-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\CCCCCOc1cccc(F)c1)Nc1ccncc1 |
| InChI | InChI=1S/C18H20FN5O/c19-15-5-4-6-17(13-15)25-12-3-1-2-9-22-18(23-14-20)24-16-7-10-21-11-8-16/h4-8,10-11,13H,1-3,9,12H2,(H2,21,22,23,24) |
| InChIKey | BAWIHWKPZGESKN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|