C29H28N8O2 — CID 164617845
1-cyano-2-[5-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypentyl]-3-pyridin-4-ylguanidine (PubChem CID 164617845) has the molecular formula C29H28N8O2 and a molecular weight of 520.60 g/mol. Its IUPAC name is 1-cyano-2-[5-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypentyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[5-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypentyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 164617845 |
| Molecular Formula | C29H28N8O2 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 1-cyano-2-[5-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]oxypentyl]-3-pyridin-4-ylguanidine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(OCCCCC/N=C(\NC#N)Nc4ccncc4)cc23)c1 |
| InChI | InChI=1S/C29H28N8O2/c1-3-21-8-7-9-23(16-21)36-28-24-17-27(26(38-2)18-25(24)34-20-35-28)39-15-6-4-5-12-32-29(33-19-30)37-22-10-13-31-14-11-22/h1,7-11,13-14,16-18,20H,4-6,12,15H2,2H3,(H,34,35,36)(H2,31,32,33,37) |
| InChIKey | XHHRYYIEFNUMAA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|