C20H22F3N5O2 — CID 53346396
1-cyano-3-pyridin-3-yl-2-[6-[2-(trifluoromethoxy)phenoxy]hexyl]guanidine (PubChem CID 53346396) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is 1-cyano-3-pyridin-3-yl-2-[6-[2-(trifluoromethoxy)phenoxy]hexyl]guanidine.
| Compound Name | 1-cyano-3-pyridin-3-yl-2-[6-[2-(trifluoromethoxy)phenoxy]hexyl]guanidine |
|---|---|
| PubChem CID | 53346396 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1-cyano-3-pyridin-3-yl-2-[6-[2-(trifluoromethoxy)phenoxy]hexyl]guanidine |
| SMILES | N#CN/C(=N\CCCCCCOc1ccccc1OC(F)(F)F)Nc1cccnc1 |
| InChI | InChI=1S/C20H22F3N5O2/c21-20(22,23)30-18-10-4-3-9-17(18)29-13-6-2-1-5-12-26-19(27-15-24)28-16-8-7-11-25-14-16/h3-4,7-11,14H,1-2,5-6,12-13H2,(H2,26,27,28) |
| InChIKey | RRYOOPRULMUPKS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|