C22H22N6OS — CID 118565479
1-cyano-2-[3-[(2-phenylphenyl)sulfinylamino]propyl]-3-pyridin-3-ylguanidine (PubChem CID 118565479) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is 1-cyano-2-[3-[(2-phenylphenyl)sulfinylamino]propyl]-3-pyridin-3-ylguanidine.
| Compound Name | 1-cyano-2-[3-[(2-phenylphenyl)sulfinylamino]propyl]-3-pyridin-3-ylguanidine |
|---|---|
| PubChem CID | 118565479 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-cyano-2-[3-[(2-phenylphenyl)sulfinylamino]propyl]-3-pyridin-3-ylguanidine |
| SMILES | N#CN/C(=N\CCCNS(=O)c1ccccc1-c1ccccc1)Nc1cccnc1 |
| InChI | InChI=1S/C22H22N6OS/c23-17-26-22(28-19-10-6-13-24-16-19)25-14-7-15-27-30(29)21-12-5-4-11-20(21)18-8-2-1-3-9-18/h1-6,8-13,16,27H,7,14-15H2,(H2,25,26,28) |
| InChIKey | KBTWFVLPELLNRL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|