C26H22N6O2S — CID 89307081
1-cyano-3-[4-[(2-phenylphenyl)sulfonylamino]phenyl]-2-(pyridin-3-ylmethyl)guanidine (PubChem CID 89307081) has the molecular formula C26H22N6O2S and a molecular weight of 482.57 g/mol. Its IUPAC name is 1-cyano-3-[4-[(2-phenylphenyl)sulfonylamino]phenyl]-2-(pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-cyano-3-[4-[(2-phenylphenyl)sulfonylamino]phenyl]-2-(pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 89307081 |
| Molecular Formula | C26H22N6O2S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-cyano-3-[4-[(2-phenylphenyl)sulfonylamino]phenyl]-2-(pyridin-3-ylmethyl)guanidine |
| SMILES | N#CN/C(=N\Cc1cccnc1)Nc1ccc(NS(=O)(=O)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N6O2S/c27-19-30-26(29-18-20-7-6-16-28-17-20)31-22-12-14-23(15-13-22)32-35(33,34)25-11-5-4-10-24(25)21-8-2-1-3-9-21/h1-17,32H,18H2,(H2,29,30,31) |
| InChIKey | BZYAFKPTXFOFJC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|