C26H26N6O2S — CID 123385633
1-amino-3-(3-methyl-4-pyridinyl)-2-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methyl]guanidine (PubChem CID 123385633) has the molecular formula C26H26N6O2S and a molecular weight of 486.60 g/mol. Its IUPAC name is 1-amino-3-(3-methyl-4-pyridinyl)-2-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methyl]guanidine.
| Compound Name | 1-amino-3-(3-methyl-4-pyridinyl)-2-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 123385633 |
| Molecular Formula | C26H26N6O2S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-amino-3-(3-methyl-4-pyridinyl)-2-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methyl]guanidine |
| SMILES | Cc1cnccc1N/C(=N/Cc1ccc(NS(=O)(=O)c2ccccc2-c2ccccc2)cc1)NN |
| InChI | InChI=1S/C26H26N6O2S/c1-19-17-28-16-15-24(19)30-26(31-27)29-18-20-11-13-22(14-12-20)32-35(33,34)25-10-6-5-9-23(25)21-7-3-2-4-8-21/h2-17,32H,18,27H2,1H3,(H2,28,29,30,31) |
| InChIKey | TXEGUWCNEBQFFP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|