C26H25N6O2S+ — CID 123878774
imino-[[(2-methyl-4-pyridinyl)amino]-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methylamino]methylidene]azanium (PubChem CID 123878774) has the molecular formula C26H25N6O2S+ and a molecular weight of 485.59 g/mol. Its IUPAC name is imino-[[(2-methyl-4-pyridinyl)amino]-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methylamino]methylidene]azanium.
| Compound Name | imino-[[(2-methyl-4-pyridinyl)amino]-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methylamino]methylidene]azanium |
|---|---|
| PubChem CID | 123878774 |
| Molecular Formula | C26H25N6O2S+ |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | imino-[[(2-methyl-4-pyridinyl)amino]-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methylamino]methylidene]azanium |
| SMILES | Cc1cc(NC(=[N+]=N)NCc2ccc(NS(=O)(=O)c3ccccc3-c3ccccc3)cc2)ccn1 |
| InChI | InChI=1S/C26H24N6O2S/c1-19-17-23(15-16-28-19)30-26(31-27)29-18-20-11-13-22(14-12-20)32-35(33,34)25-10-6-5-9-24(25)21-7-3-2-4-8-21/h2-17,27,32H,18H2,1H3,(H,28,29,30)/p+1 |
| InChIKey | UNQGHVZIJMZFSC-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|