C26H21Cl2N3O3S — CID 71140307
1-[(3,5-dichlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfonylamino]phenyl]urea (PubChem CID 71140307) has the molecular formula C26H21Cl2N3O3S and a molecular weight of 526.45 g/mol. Its IUPAC name is 1-[(3,5-dichlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfonylamino]phenyl]urea.
| Compound Name | 1-[(3,5-dichlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfonylamino]phenyl]urea |
|---|---|
| PubChem CID | 71140307 |
| Molecular Formula | C26H21Cl2N3O3S |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 1-[(3,5-dichlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfonylamino]phenyl]urea |
| SMILES | O=C(NCc1cc(Cl)cc(Cl)c1)Nc1ccc(NS(=O)(=O)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21Cl2N3O3S/c27-20-14-18(15-21(28)16-20)17-29-26(32)30-22-10-12-23(13-11-22)31-35(33,34)25-9-5-4-8-24(25)19-6-2-1-3-7-19/h1-16,31H,17H2,(H2,29,30,32) |
| InChIKey | NJRLVFVMSBPVID-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |