C26H21Cl2N3OS — CID 123234862
1-[(3,5-dichlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea (PubChem CID 123234862) has the molecular formula C26H21Cl2N3OS and a molecular weight of 494.45 g/mol. Its IUPAC name is 1-[(3,5-dichlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea.
| Compound Name | 1-[(3,5-dichlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea |
|---|---|
| PubChem CID | 123234862 |
| Molecular Formula | C26H21Cl2N3OS |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 1-[(3,5-dichlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea |
| SMILES | O=C(NCc1cc(Cl)cc(Cl)c1)Nc1ccc(NSc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21Cl2N3OS/c27-20-14-18(15-21(28)16-20)17-29-26(32)30-22-10-12-23(13-11-22)31-33-25-9-5-4-8-24(25)19-6-2-1-3-7-19/h1-16,31H,17H2,(H2,29,30,32) |
| InChIKey | PTKPSMKYPHQOCO-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|