C28H24N4OS — CID 123502294
1-(1H-indol-6-ylmethyl)-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea (PubChem CID 123502294) has the molecular formula C28H24N4OS and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-(1H-indol-6-ylmethyl)-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea.
| Compound Name | 1-(1H-indol-6-ylmethyl)-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea |
|---|---|
| PubChem CID | 123502294 |
| Molecular Formula | C28H24N4OS |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 1-(1H-indol-6-ylmethyl)-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea |
| SMILES | O=C(NCc1ccc2cc[nH]c2c1)Nc1ccc(NSc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N4OS/c33-28(30-19-20-10-11-22-16-17-29-26(22)18-20)31-23-12-14-24(15-13-23)32-34-27-9-5-4-8-25(27)21-6-2-1-3-7-21/h1-18,29,32H,19H2,(H2,30,31,33) |
| InChIKey | LFPALRQCPZTFFF-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|