C26H22ClN3OS — CID 123573415
1-[(4-chlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea (PubChem CID 123573415) has the molecular formula C26H22ClN3OS and a molecular weight of 460.00 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea |
|---|---|
| PubChem CID | 123573415 |
| Molecular Formula | C26H22ClN3OS |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(2-phenylphenyl)sulfanylamino]phenyl]urea |
| SMILES | O=C(NCc1ccc(Cl)cc1)Nc1ccc(NSc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22ClN3OS/c27-21-12-10-19(11-13-21)18-28-26(31)29-22-14-16-23(17-15-22)30-32-25-9-5-4-8-24(25)20-6-2-1-3-7-20/h1-17,30H,18H2,(H2,28,29,31) |
| InChIKey | ZVYJFKNMTPDTHX-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|