C25H21ClN4O3S — CID 88907437
1-(2-chloro-4-pyridinyl)-3-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methyl]urea (PubChem CID 88907437) has the molecular formula C25H21ClN4O3S and a molecular weight of 492.99 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridinyl)-3-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methyl]urea.
| Compound Name | 1-(2-chloro-4-pyridinyl)-3-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methyl]urea |
|---|---|
| PubChem CID | 88907437 |
| Molecular Formula | C25H21ClN4O3S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 1-(2-chloro-4-pyridinyl)-3-[[4-[(2-phenylphenyl)sulfonylamino]phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(NS(=O)(=O)c2ccccc2-c2ccccc2)cc1)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C25H21ClN4O3S/c26-24-16-21(14-15-27-24)29-25(31)28-17-18-10-12-20(13-11-18)30-34(32,33)23-9-5-4-8-22(23)19-6-2-1-3-7-19/h1-16,30H,17H2,(H2,27,28,29,31) |
| InChIKey | OSDPMXNXYRMIQJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|