C23H21N5O3S — CID 72544237
1-[4-[(4-aminonaphthalen-1-yl)sulfonylamino]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 72544237) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is 1-[4-[(4-aminonaphthalen-1-yl)sulfonylamino]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[(4-aminonaphthalen-1-yl)sulfonylamino]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 72544237 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 1-[4-[(4-aminonaphthalen-1-yl)sulfonylamino]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccc(NC(=O)NCc3cccnc3)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H21N5O3S/c24-21-11-12-22(20-6-2-1-5-19(20)21)32(30,31)28-18-9-7-17(8-10-18)27-23(29)26-15-16-4-3-13-25-14-16/h1-14,28H,15,24H2,(H2,26,27,29) |
| InChIKey | GFGDIXTVUPFAJY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|