C12H18N6 — CID 141141789
1-(4-aminobutyl)-3-cyano-2-(pyridin-3-ylmethyl)guanidine (PubChem CID 141141789) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is 1-(4-aminobutyl)-3-cyano-2-(pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-(4-aminobutyl)-3-cyano-2-(pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 141141789 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 1-(4-aminobutyl)-3-cyano-2-(pyridin-3-ylmethyl)guanidine |
| SMILES | N#CN/C(=N\Cc1cccnc1)NCCCCN |
| InChI | InChI=1S/C12H18N6/c13-5-1-2-7-16-12(18-10-14)17-9-11-4-3-6-15-8-11/h3-4,6,8H,1-2,5,7,9,13H2,(H2,16,17,18) |
| InChIKey | BABWOOGQFGCBTI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|