C18H21F3N4 — CID 111421029
1-ethyl-3-(2-pyridin-3-ylethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111421029) has the molecular formula C18H21F3N4 and a molecular weight of 350.39 g/mol. Its IUPAC name is 1-ethyl-3-(2-pyridin-3-ylethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-pyridin-3-ylethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111421029 |
| Molecular Formula | C18H21F3N4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-ethyl-3-(2-pyridin-3-ylethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCCc1cccnc1 |
| InChI | InChI=1S/C18H21F3N4/c1-2-23-17(24-11-9-14-4-3-10-22-12-14)25-13-15-5-7-16(8-6-15)18(19,20)21/h3-8,10,12H,2,9,11,13H2,1H3,(H2,23,24,25) |
| InChIKey | NRFAZHKZSJARAM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|