C16H20F3N5 — CID 111420497
1-ethyl-3-(2-imidazol-1-ylethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111420497) has the molecular formula C16H20F3N5 and a molecular weight of 339.37 g/mol. Its IUPAC name is 1-ethyl-3-(2-imidazol-1-ylethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-imidazol-1-ylethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111420497 |
| Molecular Formula | C16H20F3N5 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-ethyl-3-(2-imidazol-1-ylethyl)-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCCn1ccnc1 |
| InChI | InChI=1S/C16H20F3N5/c1-2-21-15(22-8-10-24-9-7-20-12-24)23-11-13-3-5-14(6-4-13)16(17,18)19/h3-7,9,12H,2,8,10-11H2,1H3,(H2,21,22,23) |
| InChIKey | KUVZXTNKHQSBFD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|