C20H29IN4 — CID 111043145
1-butyl-2-[(4-methylphenyl)methyl]-3-(2-pyridin-3-ylethyl)guanidine;hydroiodide (PubChem CID 111043145) has the molecular formula C20H29IN4 and a molecular weight of 452.38 g/mol. Its IUPAC name is 1-butyl-2-[(4-methylphenyl)methyl]-3-(2-pyridin-3-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-butyl-2-[(4-methylphenyl)methyl]-3-(2-pyridin-3-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111043145 |
| Molecular Formula | C20H29IN4 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 1-butyl-2-[(4-methylphenyl)methyl]-3-(2-pyridin-3-ylethyl)guanidine;hydroiodide |
| SMILES | CCCCN/C(=N\Cc1ccc(C)cc1)NCCc1cccnc1.I |
| InChI | InChI=1S/C20H28N4.HI/c1-3-4-13-22-20(23-14-11-18-6-5-12-21-15-18)24-16-19-9-7-17(2)8-10-19;/h5-10,12,15H,3-4,11,13-14,16H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | DDURQICJVSZUEJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|