C19H24F3IN4O — CID 111871604
1-ethyl-3-(2-pyridin-3-ylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111871604) has the molecular formula C19H24F3IN4O and a molecular weight of 508.33 g/mol. Its IUPAC name is 1-ethyl-3-(2-pyridin-3-ylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-pyridin-3-ylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111871604 |
| Molecular Formula | C19H24F3IN4O |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 1-ethyl-3-(2-pyridin-3-ylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCCc1cccnc1.I |
| InChI | InChI=1S/C19H23F3N4O.HI/c1-2-24-18(25-11-9-15-4-3-10-23-12-15)26-13-16-5-7-17(8-6-16)27-14-19(20,21)22;/h3-8,10,12H,2,9,11,13-14H2,1H3,(H2,24,25,26);1H |
| InChIKey | FNTWUNBOBGKLQF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|