C15H26N4O2S — CID 111046619
1-butyl-2-[(4-methylphenyl)methyl]-3-(2-sulfamoylethyl)guanidine (PubChem CID 111046619) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is 1-butyl-2-[(4-methylphenyl)methyl]-3-(2-sulfamoylethyl)guanidine.
| Compound Name | 1-butyl-2-[(4-methylphenyl)methyl]-3-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111046619 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-butyl-2-[(4-methylphenyl)methyl]-3-(2-sulfamoylethyl)guanidine |
| SMILES | CCCCN/C(=N\Cc1ccc(C)cc1)NCCS(N)(=O)=O |
| InChI | InChI=1S/C15H26N4O2S/c1-3-4-9-17-15(18-10-11-22(16,20)21)19-12-14-7-5-13(2)6-8-14/h5-8H,3-4,9-12H2,1-2H3,(H2,16,20,21)(H2,17,18,19) |
| InChIKey | SSDIORYHJVKBQN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|