C19H35IN4O2S — CID 111066410
1-butyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[(4-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111066410) has the molecular formula C19H35IN4O2S and a molecular weight of 510.49 g/mol. Its IUPAC name is 1-butyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[(4-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[(4-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111066410 |
| Molecular Formula | C19H35IN4O2S |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 1-butyl-3-[3-[ethylsulfonyl(methyl)amino]propyl]-2-[(4-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(=N\Cc1ccc(C)cc1)NCCCN(C)S(=O)(=O)CC.I |
| InChI | InChI=1S/C19H34N4O2S.HI/c1-5-7-13-20-19(22-16-18-11-9-17(3)10-12-18)21-14-8-15-23(4)26(24,25)6-2;/h9-12H,5-8,13-16H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | PTYYTVAEXTUVBB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|