C18H21BrN6 — CID 14537447
1-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-3-cyano-2-(pyridin-3-ylmethyl)guanidine (PubChem CID 14537447) has the molecular formula C18H21BrN6 and a molecular weight of 401.31 g/mol. Its IUPAC name is 1-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-3-cyano-2-(pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-3-cyano-2-(pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 14537447 |
| Molecular Formula | C18H21BrN6 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 1-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-3-cyano-2-(pyridin-3-ylmethyl)guanidine |
| SMILES | Cc1cc(Br)cnc1CCCCN/C(=N/Cc1cccnc1)NC#N |
| InChI | InChI=1S/C18H21BrN6/c1-14-9-16(19)12-23-17(14)6-2-3-8-22-18(25-13-20)24-11-15-5-4-7-21-10-15/h4-5,7,9-10,12H,2-3,6,8,11H2,1H3,(H2,22,24,25) |
| InChIKey | PSKWAFMCAWBWAZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|