C19H22BrN5OS — CID 15962358
3-N-benzyl-4-N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine (PubChem CID 15962358) has the molecular formula C19H22BrN5OS and a molecular weight of 448.39 g/mol. Its IUPAC name is 3-N-benzyl-4-N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 3-N-benzyl-4-N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 15962358 |
| Molecular Formula | C19H22BrN5OS |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 3-N-benzyl-4-N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine |
| SMILES | Cc1cc(Br)cnc1CCCCNC1=NS(=O)N=C1NCc1ccccc1 |
| InChI | InChI=1S/C19H22BrN5OS/c1-14-11-16(20)13-22-17(14)9-5-6-10-21-18-19(25-27(26)24-18)23-12-15-7-3-2-4-8-15/h2-4,7-8,11,13H,5-6,9-10,12H2,1H3,(H,21,24)(H,23,25) |
| InChIKey | RFBXOTKFMLFYHW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|