C15H25BrN6O2S — CID 86740210
3-N-[4-(3-amino-5-bromo-2-pyridinyl)butyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine;ethoxyethane (PubChem CID 86740210) has the molecular formula C15H25BrN6O2S and a molecular weight of 433.38 g/mol. Its IUPAC name is 3-N-[4-(3-amino-5-bromo-2-pyridinyl)butyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine;ethoxyethane.
| Compound Name | 3-N-[4-(3-amino-5-bromo-2-pyridinyl)butyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine;ethoxyethane |
|---|---|
| PubChem CID | 86740210 |
| Molecular Formula | C15H25BrN6O2S |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 3-N-[4-(3-amino-5-bromo-2-pyridinyl)butyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine;ethoxyethane |
| SMILES | CCOCC.NC1=NS(=O)N=C1NCCCCc1ncc(Br)cc1N |
| InChI | InChI=1S/C11H15BrN6OS.C4H10O/c12-7-5-8(13)9(16-6-7)3-1-2-4-15-11-10(14)17-20(19)18-11;1-3-5-4-2/h5-6H,1-4,13H2,(H2,14,17)(H,15,18);3-4H2,1-2H3 |
| InChIKey | HCWLWKOMMYFTLM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|