C20H25BrN4 — CID 154478018
1-N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-2-N-(pyridin-3-ylmethyl)cyclobutene-1,2-diamine (PubChem CID 154478018) has the molecular formula C20H25BrN4 and a molecular weight of 401.35 g/mol. Its IUPAC name is 1-N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-2-N-(pyridin-3-ylmethyl)cyclobutene-1,2-diamine.
| Compound Name | 1-N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-2-N-(pyridin-3-ylmethyl)cyclobutene-1,2-diamine |
|---|---|
| PubChem CID | 154478018 |
| Molecular Formula | C20H25BrN4 |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-N-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-2-N-(pyridin-3-ylmethyl)cyclobutene-1,2-diamine |
| SMILES | Cc1cc(Br)cnc1CCCCNC1=C(NCc2cccnc2)CC1 |
| InChI | InChI=1S/C20H25BrN4/c1-15-11-17(21)14-25-18(15)6-2-3-10-23-19-7-8-20(19)24-13-16-5-4-9-22-12-16/h4-5,9,11-12,14,23-24H,2-3,6-8,10,13H2,1H3 |
| InChIKey | MVVHFIDTIUXYND-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|