C21H26BrN5 — CID 14537445
1-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-3-cyano-2-(3-phenylpropyl)guanidine (PubChem CID 14537445) has the molecular formula C21H26BrN5 and a molecular weight of 428.38 g/mol. Its IUPAC name is 1-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-3-cyano-2-(3-phenylpropyl)guanidine.
| Compound Name | 1-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-3-cyano-2-(3-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 14537445 |
| Molecular Formula | C21H26BrN5 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-[4-(5-bromo-3-methyl-2-pyridinyl)butyl]-3-cyano-2-(3-phenylpropyl)guanidine |
| SMILES | Cc1cc(Br)cnc1CCCCN/C(=N/CCCc1ccccc1)NC#N |
| InChI | InChI=1S/C21H26BrN5/c1-17-14-19(22)15-26-20(17)11-5-6-12-24-21(27-16-23)25-13-7-10-18-8-3-2-4-9-18/h2-4,8-9,14-15H,5-7,10-13H2,1H3,(H2,24,25,27) |
| InChIKey | HGLXCCXIMYVQQM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|