C24H26N6O — CID 13103591
1-cyano-2-[4-(6-oxo-3-phenylpyridazin-1-yl)butyl]-3-(2-phenylethyl)guanidine (PubChem CID 13103591) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 1-cyano-2-[4-(6-oxo-3-phenylpyridazin-1-yl)butyl]-3-(2-phenylethyl)guanidine.
| Compound Name | 1-cyano-2-[4-(6-oxo-3-phenylpyridazin-1-yl)butyl]-3-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 13103591 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1-cyano-2-[4-(6-oxo-3-phenylpyridazin-1-yl)butyl]-3-(2-phenylethyl)guanidine |
| SMILES | N#CN/C(=N\CCCCn1nc(-c2ccccc2)ccc1=O)NCCc1ccccc1 |
| InChI | InChI=1S/C24H26N6O/c25-19-28-24(27-17-15-20-9-3-1-4-10-20)26-16-7-8-18-30-23(31)14-13-22(29-30)21-11-5-2-6-12-21/h1-6,9-14H,7-8,15-18H2,(H2,26,27,28) |
| InChIKey | JMXIHQGDHDUOJD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|