C18H22N6OS — CID 13048165
1-cyano-2-methyl-3-[2-[3-(6-oxo-3-phenylpyridazin-1-yl)propylsulfanyl]ethyl]guanidine (PubChem CID 13048165) has the molecular formula C18H22N6OS and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[2-[3-(6-oxo-3-phenylpyridazin-1-yl)propylsulfanyl]ethyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[2-[3-(6-oxo-3-phenylpyridazin-1-yl)propylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 13048165 |
| Molecular Formula | C18H22N6OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-cyano-2-methyl-3-[2-[3-(6-oxo-3-phenylpyridazin-1-yl)propylsulfanyl]ethyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCSCCCn1nc(-c2ccccc2)ccc1=O |
| InChI | InChI=1S/C18H22N6OS/c1-20-18(22-14-19)21-10-13-26-12-5-11-24-17(25)9-8-16(23-24)15-6-3-2-4-7-15/h2-4,6-9H,5,10-13H2,1H3,(H2,20,21,22) |
| InChIKey | FGRKCSDMPIUVIL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|